C11H12N4O3S — CID 43316270
N-(2-amino-2-sulfanylideneethyl)-N'-(4-carbamoylphenyl)oxamide (PubChem CID 43316270) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(4-carbamoylphenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-carbamoylphenyl)oxamide |
|---|---|
| PubChem CID | 43316270 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(4-carbamoylphenyl)oxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(=O)NCC(N)=S)cc1 |
| InChI | InChI=1S/C11H12N4O3S/c12-8(19)5-14-10(17)11(18)15-7-3-1-6(2-4-7)9(13)16/h1-4H,5H2,(H2,12,19)(H2,13,16)(H,14,17)(H,15,18) |
| InChIKey | NDNVACPHNMVWER-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|