C10H11N3O2S — CID 28942422
4-[(3-amino-3-sulfanylidenepropanoyl)amino]benzamide (PubChem CID 28942422) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 4-[(3-amino-3-sulfanylidenepropanoyl)amino]benzamide.
| Compound Name | 4-[(3-amino-3-sulfanylidenepropanoyl)amino]benzamide |
|---|---|
| PubChem CID | 28942422 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-[(3-amino-3-sulfanylidenepropanoyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CC(N)=S)cc1 |
| InChI | InChI=1S/C10H11N3O2S/c11-8(16)5-9(14)13-7-3-1-6(2-4-7)10(12)15/h1-4H,5H2,(H2,11,16)(H2,12,15)(H,13,14) |
| InChIKey | LLIMRSSCIBGYKX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|