C14H16N2O4 — CID 8673185
[2-(4-carbamoylanilino)-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673185) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673185 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-2-3-4-13(18)20-9-12(17)16-11-7-5-10(6-8-11)14(15)19/h3-8H,2,9H2,1H3,(H2,15,19)(H,16,17)/b4-3+ |
| InChIKey | OUFILSVAJWBCRJ-ONEGZZNKSA-N |
| XLogP | 1.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|