C16H17NO7 — CID 7851825
1-O-ethyl 4-O-[2-(4-methoxycarbonylanilino)-2-oxoethyl] (E)-but-2-enedioate (PubChem CID 7851825) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is 1-O-ethyl 4-O-[2-(4-methoxycarbonylanilino)-2-oxoethyl] (E)-but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-[2-(4-methoxycarbonylanilino)-2-oxoethyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851825 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 1-O-ethyl 4-O-[2-(4-methoxycarbonylanilino)-2-oxoethyl] (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C16H17NO7/c1-3-23-14(19)8-9-15(20)24-10-13(18)17-12-6-4-11(5-7-12)16(21)22-2/h4-9H,3,10H2,1-2H3,(H,17,18)/b9-8+ |
| InChIKey | GVKLXLVDIKGOGI-CMDGGOBGSA-N |
| XLogP | 1.07 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|