C23H25NO8 — CID 40824635
ethyl 4-[[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzoate (PubChem CID 40824635) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is ethyl 4-[[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 40824635 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | ethyl 4-[[2-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H25NO8/c1-5-31-23(27)16-7-9-17(10-8-16)24-20(25)14-32-21(26)11-6-15-12-18(28-2)22(30-4)19(13-15)29-3/h6-13H,5,14H2,1-4H3,(H,24,25)/b11-6+ |
| InChIKey | OGJAFONUOWVEFL-IZZDOVSWSA-N |
| XLogP | 3.08 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|