C24H29NO6 — CID 71823147
[2-(4-butylanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 71823147) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71823147 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCCCc1ccc(NC(=O)COC(=O)C=Cc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-5-6-7-17-8-11-19(12-9-17)25-22(26)16-31-23(27)13-10-18-14-20(28-2)24(30-4)21(15-18)29-3/h8-15H,5-7,16H2,1-4H3,(H,25,26) |
| InChIKey | ZQEVMIZZVSNBBA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|