C21H21F2NO6S — CID 2360241
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 2360241) has the molecular formula C21H21F2NO6S and a molecular weight of 453.46 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2360241 |
| Molecular Formula | C21H21F2NO6S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(SC(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21F2NO6S/c1-27-16-10-13(11-17(28-2)20(16)29-3)4-9-19(26)30-12-18(25)24-14-5-7-15(8-6-14)31-21(22)23/h4-11,21H,12H2,1-3H3,(H,24,25)/b9-4+ |
| InChIKey | RKZYIWGCUIRDHG-RUDMXATFSA-N |
| XLogP | 4.22 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|