C19H15F2NO5S — CID 6212403
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 6212403) has the molecular formula C19H15F2NO5S and a molecular weight of 407.39 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6212403 |
| Molecular Formula | C19H15F2NO5S |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc2c(c1)OCO2)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H15F2NO5S/c20-19(21)28-14-5-3-13(4-6-14)22-17(23)10-25-18(24)8-2-12-1-7-15-16(9-12)27-11-26-15/h1-9,19H,10-11H2,(H,22,23)/b8-2+ |
| InChIKey | ZGOCFMCTEYONNJ-KRXBUXKQSA-N |
| XLogP | 3.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|