C26H22N2O7 — CID 35975008
[2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 35975008) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 35975008 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [2-[4-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)COC(=O)/C=C/c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O7/c1-32-21-10-8-20(9-11-21)28-26(31)18-4-6-19(7-5-18)27-24(29)15-33-25(30)13-3-17-2-12-22-23(14-17)35-16-34-22/h2-14H,15-16H2,1H3,(H,27,29)(H,28,31)/b13-3+ |
| InChIKey | ZKHWQDXTUMIBNN-QLKAYGNNSA-N |
| XLogP | 3.87 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|