C18H14INO5 — CID 3921641
[2-(3-iodoanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 3921641) has the molecular formula C18H14INO5 and a molecular weight of 451.22 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3921641 |
| Molecular Formula | C18H14INO5 |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 450.99 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc2c(c1)OCO2)Nc1cccc(I)c1 |
| InChI | InChI=1S/C18H14INO5/c19-13-2-1-3-14(9-13)20-17(21)10-23-18(22)7-5-12-4-6-15-16(8-12)25-11-24-15/h1-9H,10-11H2,(H,20,21) |
| InChIKey | HKYNQGKKBDBUIN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|