C19H14F3NO5 — CID 2556288
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 2556288) has the molecular formula C19H14F3NO5 and a molecular weight of 393.32 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2556288 |
| Molecular Formula | C19H14F3NO5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc2c(c1)OCO2)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3NO5/c20-19(21,22)13-2-1-3-14(9-13)23-17(24)10-26-18(25)7-5-12-4-6-15-16(8-12)28-11-27-15/h1-9H,10-11H2,(H,23,24)/b7-5+ |
| InChIKey | VFGUERAZWJCHQP-FNORWQNLSA-N |
| XLogP | 3.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|