C19H16F3NO4 — CID 6212584
[2-(3-methoxyanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 6212584) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6212584 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | COc1cccc(NC(=O)COC(=O)/C=C/c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H16F3NO4/c1-26-16-7-3-6-15(11-16)23-17(24)12-27-18(25)9-8-13-4-2-5-14(10-13)19(20,21)22/h2-11H,12H2,1H3,(H,23,24)/b9-8+ |
| InChIKey | DMYNFTOSZBCQKX-CMDGGOBGSA-N |
| XLogP | 3.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|