C13H15NO4 — CID 2508134
[2-(3-methoxyanilino)-2-oxoethyl] (E)-but-2-enoate (PubChem CID 2508134) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 2508134 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C13H15NO4/c1-3-5-13(16)18-9-12(15)14-10-6-4-7-11(8-10)17-2/h3-8H,9H2,1-2H3,(H,14,15)/b5-3+ |
| InChIKey | XFYYJUKLVFVAKA-HWKANZROSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|