C18H16ClNO4 — CID 2511947
[2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 2511947) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2511947 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | COc1cccc(NC(=O)COC(=O)/C=C/c2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H16ClNO4/c1-23-15-7-4-6-14(11-15)20-17(21)12-24-18(22)10-9-13-5-2-3-8-16(13)19/h2-11H,12H2,1H3,(H,20,21)/b10-9+ |
| InChIKey | CYTPDVXQUNRIQV-MDZDMXLPSA-N |
| XLogP | 3.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|