C21H22ClNO6 — CID 7254443
[2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 7254443) has the molecular formula C21H22ClNO6 and a molecular weight of 419.86 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7254443 |
| Molecular Formula | C21H22ClNO6 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)Nc2cccc(OC)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H22ClNO6/c1-4-28-18-11-14(10-17(22)21(18)27-3)8-9-20(25)29-13-19(24)23-15-6-5-7-16(12-15)26-2/h5-12H,4,13H2,1-3H3,(H,23,24)/b9-8+ |
| InChIKey | MHTGPOOHGBZVPE-CMDGGOBGSA-N |
| XLogP | 3.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|