C21H20ClF2NO6 — CID 41146129
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 41146129) has the molecular formula C21H20ClF2NO6 and a molecular weight of 455.84 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 41146129 |
| Molecular Formula | C21H20ClF2NO6 |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H20ClF2NO6/c1-3-29-17-11-13(10-16(22)20(17)28-2)4-9-19(27)30-12-18(26)25-14-5-7-15(8-6-14)31-21(23)24/h4-11,21H,3,12H2,1-2H3,(H,25,26)/b9-4+ |
| InChIKey | UPLHQCDRXWWTGT-RUDMXATFSA-N |
| XLogP | 4.54 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|