C24H19NO6 — CID 8925714
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (E)-3-(3-phenoxyphenyl)prop-2-enoate (PubChem CID 8925714) has the molecular formula C24H19NO6 and a molecular weight of 417.42 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (E)-3-(3-phenoxyphenyl)prop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (E)-3-(3-phenoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8925714 |
| Molecular Formula | C24H19NO6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (E)-3-(3-phenoxyphenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(Oc2ccccc2)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19NO6/c26-23(25-18-10-11-21-22(14-18)30-16-29-21)15-28-24(27)12-9-17-5-4-8-20(13-17)31-19-6-2-1-3-7-19/h1-14H,15-16H2,(H,25,26)/b12-9+ |
| InChIKey | AVLVKMNLDZPITN-FMIVXFBMSA-N |
| XLogP | 4.40 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|