C29H29NO6 — CID 2478170
[2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 2478170) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2478170 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)COC(=O)/C=C/c3ccc4c(c3)OCO4)cc2)cc1 |
| InChI | InChI=1S/C29H29NO6/c1-4-29(2,3)21-7-11-23(12-8-21)36-24-13-9-22(10-14-24)30-27(31)18-33-28(32)16-6-20-5-15-25-26(17-20)35-19-34-25/h5-17H,4,18-19H2,1-3H3,(H,30,31)/b16-6+ |
| InChIKey | DDPFCBSAKQBQAP-OMCISZLKSA-N |
| XLogP | 6.09 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|