C23H26N2O7S — CID 6218374
[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 6218374) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 6218374 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COC(=O)/C=C/c2ccc3c(c2)OCO3)ccc1C |
| InChI | InChI=1S/C23H26N2O7S/c1-4-25(5-2)33(28,29)21-13-18(9-6-16(21)3)24-22(26)14-30-23(27)11-8-17-7-10-19-20(12-17)32-15-31-19/h6-13H,4-5,14-15H2,1-3H3,(H,24,26)/b11-8+ |
| InChIKey | VIYLDDQGHWSFPH-DHZHZOJOSA-N |
| XLogP | 2.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|