C20H20N2O7S — CID 4123476
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 4123476) has the molecular formula C20H20N2O7S and a molecular weight of 432.45 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4123476 |
| Molecular Formula | C20H20N2O7S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)COC(=O)C=Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H20N2O7S/c1-22(2)30(25,26)16-5-3-4-15(11-16)21-19(23)12-27-20(24)9-7-14-6-8-17-18(10-14)29-13-28-17/h3-11H,12-13H2,1-2H3,(H,21,23) |
| InChIKey | TUDSQVSFYXACCF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|