C21H23N3O8S — CID 16565399
[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 16565399) has the molecular formula C21H23N3O8S and a molecular weight of 477.50 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 16565399 |
| Molecular Formula | C21H23N3O8S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | C/C(=N\OCC(=O)OCC(=O)Nc1cccc(S(=O)(=O)N(C)C)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H23N3O8S/c1-14(15-7-8-18-19(9-15)31-13-30-18)23-32-12-21(26)29-11-20(25)22-16-5-4-6-17(10-16)33(27,28)24(2)3/h4-10H,11-13H2,1-3H3,(H,22,25)/b23-14+ |
| InChIKey | KGGZCGQZMNSWDQ-OEAKJJBVSA-N |
| XLogP | 1.59 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|