C18H17N3O5 — CID 9207174
4-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]benzamide (PubChem CID 9207174) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]benzamide.
| Compound Name | 4-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]benzamide |
|---|---|
| PubChem CID | 9207174 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[[2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetyl]amino]benzamide |
| SMILES | C/C(=N/OCC(=O)Nc1ccc(C(N)=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17N3O5/c1-11(13-4-7-15-16(8-13)25-10-24-15)21-26-9-17(22)20-14-5-2-12(3-6-14)18(19)23/h2-8H,9-10H2,1H3,(H2,19,23)(H,20,22)/b21-11- |
| InChIKey | BFUMHXKJLNMKKC-NHDPSOOVSA-N |
| XLogP | 1.89 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|