C19H17N3O4 — CID 9261308
2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[4-(cyanomethyl)phenyl]acetamide (PubChem CID 9261308) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[4-(cyanomethyl)phenyl]acetamide.
| Compound Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[4-(cyanomethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9261308 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[4-(cyanomethyl)phenyl]acetamide |
| SMILES | C/C(=N/OCC(=O)Nc1ccc(CC#N)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17N3O4/c1-13(15-4-7-17-18(10-15)25-12-24-17)22-26-11-19(23)21-16-5-2-14(3-6-16)8-9-20/h2-7,10H,8,11-12H2,1H3,(H,21,23)/b22-13- |
| InChIKey | MLZBMVKFBRIYTJ-XKZIYDEJSA-N |
| XLogP | 2.86 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|