C24H30N3O4+ — CID 8546740
2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 8546740) has the molecular formula C24H30N3O4+ and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8546740 |
| Molecular Formula | C24H30N3O4+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-[[4-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | C/C(=N/OCC(=O)NCc1ccc(C[NH+]2CCCCC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H29N3O4/c1-18(21-9-10-22-23(13-21)30-17-29-22)26-31-16-24(28)25-14-19-5-7-20(8-6-19)15-27-11-3-2-4-12-27/h5-10,13H,2-4,11-12,14-17H2,1H3,(H,25,28)/p+1/b26-18- |
| InChIKey | UDRFSAQKTYEMAO-ITYLOYPMSA-O |
| XLogP | 2.04 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|