C16H22N2O4 — CID 60605268
2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-pentan-3-ylacetamide (PubChem CID 60605268) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-pentan-3-ylacetamide.
| Compound Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 60605268 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxy-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CO/N=C(/C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O4/c1-4-13(5-2)17-16(19)9-22-18-11(3)12-6-7-14-15(8-12)21-10-20-14/h6-8,13H,4-5,9-10H2,1-3H3,(H,17,19)/b18-11- |
| InChIKey | DVKYIYIZCZWOSG-WQRHYEAKSA-N |
| XLogP | 2.46 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|