C21H22N2O8 — CID 25161988
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-[1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 25161988) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-[1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-[1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 25161988 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-[1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | COc1cc(NC(=O)COC(=O)CON=C(C)c2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C21H22N2O8/c1-13(14-4-5-18-19(6-14)30-12-29-18)23-31-11-21(25)28-10-20(24)22-15-7-16(26-2)9-17(8-15)27-3/h4-9H,10-12H2,1-3H3,(H,22,24) |
| InChIKey | NSTYOCVAZKOPML-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|