C21H21NO8 — CID 8737338
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 8737338) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 8737338 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | COc1ccc(C(=O)COC(=O)CO/N=C(/C)c2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C21H21NO8/c1-13(14-4-7-18-20(8-14)29-12-28-18)22-30-11-21(24)27-10-16(23)15-5-6-17(25-2)19(9-15)26-3/h4-9H,10-12H2,1-3H3/b22-13- |
| InChIKey | ROQXMWQOEFHZEC-XKZIYDEJSA-N |
| XLogP | 2.60 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|