C22H21N3O8 — CID 41294834
[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 41294834) has the molecular formula C22H21N3O8 and a molecular weight of 455.42 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 41294834 |
| Molecular Formula | C22H21N3O8 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-[(Z)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | COc1ccc(-c2noc(COC(=O)CO/N=C(/C)c3ccc4c(c3)OCO4)n2)c(OC)c1 |
| InChI | InChI=1S/C22H21N3O8/c1-13(14-4-7-17-19(8-14)31-12-30-17)24-32-11-21(26)29-10-20-23-22(25-33-20)16-6-5-15(27-2)9-18(16)28-3/h4-9H,10-12H2,1-3H3/b24-13- |
| InChIKey | VCUKTJOVAHMWCD-CFRMEGHHSA-N |
| XLogP | 2.97 |
| TPSA | 123.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|