C25H26N2O6 — CID 55391459
[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate (PubChem CID 55391459) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate.
| Compound Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
|---|---|
| PubChem CID | 55391459 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
| SMILES | COc1ccc(-c2noc(COC(=O)CCC(=O)c3ccc4c(c3)CCCC4)n2)c(OC)c1 |
| InChI | InChI=1S/C25H26N2O6/c1-30-19-9-10-20(22(14-19)31-2)25-26-23(33-27-25)15-32-24(29)12-11-21(28)18-8-7-16-5-3-4-6-17(16)13-18/h7-10,13-14H,3-6,11-12,15H2,1-2H3 |
| InChIKey | JJXXYHPHUGYNOZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |