C19H16ClFN2O6 — CID 55394466
[2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate (PubChem CID 55394466) has the molecular formula C19H16ClFN2O6 and a molecular weight of 422.80 g/mol. Its IUPAC name is [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate.
| Compound Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 55394466 |
| Molecular Formula | C19H16ClFN2O6 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | [2-(3-chloro-4-fluoroanilino)-2-oxoethyl] 2-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]oxyacetate |
| SMILES | C/C(=N\OCC(=O)OCC(=O)Nc1ccc(F)c(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16ClFN2O6/c1-11(12-2-5-16-17(6-12)28-10-27-16)23-29-9-19(25)26-8-18(24)22-13-3-4-15(21)14(20)7-13/h2-7H,8-10H2,1H3,(H,22,24)/b23-11+ |
| InChIKey | AIOAUAIYJKXQMP-FOKLQQMPSA-N |
| XLogP | 3.13 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|