C17H25N2O3+ — CID 8583734
2-(azocan-1-ium-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide (PubChem CID 8583734) has the molecular formula C17H25N2O3+ and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8583734 |
| Molecular Formula | C17H25N2O3+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-(1,3-benzodioxol-5-ylmethyl)acetamide |
| SMILES | O=C(C[NH+]1CCCCCCC1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O3/c20-17(12-19-8-4-2-1-3-5-9-19)18-11-14-6-7-15-16(10-14)22-13-21-15/h6-7,10H,1-5,8-9,11-13H2,(H,18,20)/p+1 |
| InChIKey | OBJKLTHUQSWJNO-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |