C20H19NO5 — CID 4803815
[2-(2,3-dimethylanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 4803815) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4803815 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)C=Cc2ccc3c(c2)OCO3)c1C |
| InChI | InChI=1S/C20H19NO5/c1-13-4-3-5-16(14(13)2)21-19(22)11-24-20(23)9-7-15-6-8-17-18(10-15)26-12-25-17/h3-10H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | NQLPDXJATJPHEY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|