C18H13Cl2NO5 — CID 4857121
[2-(2,4-dichloroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 4857121) has the molecular formula C18H13Cl2NO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4857121 |
| Molecular Formula | C18H13Cl2NO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc2c(c1)OCO2)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2NO5/c19-12-3-4-14(13(20)8-12)21-17(22)9-24-18(23)6-2-11-1-5-15-16(7-11)26-10-25-15/h1-8H,9-10H2,(H,21,22) |
| InChIKey | MYPJQOSJHKFRAE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|