C15H12N2O6 — CID 16596241
[2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 16596241) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16596241 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [2-(1,2-oxazol-3-ylamino)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc2c(c1)OCO2)Nc1ccon1 |
| InChI | InChI=1S/C15H12N2O6/c18-14(16-13-5-6-23-17-13)8-20-15(19)4-2-10-1-3-11-12(7-10)22-9-21-11/h1-7H,8-9H2,(H,16,17,18)/b4-2+ |
| InChIKey | KCKWXPICRPCIEQ-DUXPYHPUSA-N |
| XLogP | 1.60 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|