C22H18N2O6 — CID 7518932
[2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7518932) has the molecular formula C22H18N2O6 and a molecular weight of 406.39 g/mol. Its IUPAC name is [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7518932 |
| Molecular Formula | C22H18N2O6 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]amino]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1ccc(-c2cc(NC(=O)COC(=O)/C=C/c3ccc4c(c3)OCO4)on2)cc1 |
| InChI | InChI=1S/C22H18N2O6/c1-14-2-6-16(7-3-14)17-11-21(30-24-17)23-20(25)12-27-22(26)9-5-15-4-8-18-19(10-15)29-13-28-18/h2-11H,12-13H2,1H3,(H,23,25)/b9-5+ |
| InChIKey | VPHUIMFTGZYWIM-WEVVVXLNSA-N |
| XLogP | 3.57 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|