C22H21NO7 — CID 7780581
propan-2-yl 4-[[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]oxyacetyl]amino]benzoate (PubChem CID 7780581) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]oxyacetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7780581 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | propan-2-yl 4-[[2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]oxyacetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)COC(=O)/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H21NO7/c1-14(2)30-22(26)16-5-7-17(8-6-16)23-20(24)12-27-21(25)10-4-15-3-9-18-19(11-15)29-13-28-18/h3-11,14H,12-13H2,1-2H3,(H,23,24)/b10-4+ |
| InChIKey | IZGKUKZJYQJJAI-ONNFQVAWSA-N |
| XLogP | 3.18 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|