C18H14N2O7 — CID 4562896
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate (PubChem CID 4562896) has the molecular formula C18H14N2O7 and a molecular weight of 370.32 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4562896 |
| Molecular Formula | C18H14N2O7 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 3-(4-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc([N+](=O)[O-])cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H14N2O7/c21-17(19-13-4-7-15-16(9-13)27-11-26-15)10-25-18(22)8-3-12-1-5-14(6-2-12)20(23)24/h1-9H,10-11H2,(H,19,21) |
| InChIKey | QQSOIOXLTIDWMH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|