C26H27NO4S — CID 2342379
[2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 2342379) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2342379 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | [2-[4-[4-(2-methylbutan-2-yl)phenoxy]anilino]-2-oxoethyl] (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(NC(=O)COC(=O)/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4S/c1-4-26(2,3)19-7-11-21(12-8-19)31-22-13-9-20(10-14-22)27-24(28)18-30-25(29)16-15-23-6-5-17-32-23/h5-17H,4,18H2,1-3H3,(H,27,28)/b16-15+ |
| InChIKey | RFEFZZZCJQBTIE-FOCLMDBBSA-N |
| XLogP | 6.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|