C26H20N2O3S2 — CID 2165477
(E)-3-thiophen-2-yl-N-[4-[4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide (PubChem CID 2165477) has the molecular formula C26H20N2O3S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (E)-3-thiophen-2-yl-N-[4-[4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-thiophen-2-yl-N-[4-[4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2165477 |
| Molecular Formula | C26H20N2O3S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (E)-3-thiophen-2-yl-N-[4-[4-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]phenoxy]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccc(Oc2ccc(NC(=O)/C=C/c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O3S2/c29-25(15-13-23-3-1-17-32-23)27-19-5-9-21(10-6-19)31-22-11-7-20(8-12-22)28-26(30)16-14-24-4-2-18-33-24/h1-18H,(H,27,29)(H,28,30)/b15-13+,16-14+ |
| InChIKey | CJEBPJDFCCLNFM-WXUKJITCSA-N |
| XLogP | 6.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|