C22H16N2O2S2 — CID 4286207
N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4286207) has the molecular formula C22H16N2O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4286207 |
| Molecular Formula | C22H16N2O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[4-(4-phenoxyphenyl)-1,3-thiazol-2-yl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)Nc1nc(-c2ccc(Oc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C22H16N2O2S2/c25-21(13-12-19-7-4-14-27-19)24-22-23-20(15-28-22)16-8-10-18(11-9-16)26-17-5-2-1-3-6-17/h1-15H,(H,23,24,25) |
| InChIKey | IQEPYTXUEXIEJS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|