C22H22N2O2S — CID 4138208
3-(4-butoxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 4138208) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(4-butoxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4138208 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-(4-butoxyphenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C22H22N2O2S/c1-2-3-15-26-19-12-9-17(10-13-19)11-14-21(25)24-22-23-20(16-27-22)18-7-5-4-6-8-18/h4-14,16H,2-3,15H2,1H3,(H,23,24,25) |
| InChIKey | AGVPHWGKSQJDTB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|