C20H20N2O2S — CID 19175586
(E)-N-(1,3-benzothiazol-2-yl)-3-(4-butoxyphenyl)prop-2-enamide (PubChem CID 19175586) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(4-butoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-butoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19175586 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-butoxyphenyl)prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-2-3-14-24-16-11-8-15(9-12-16)10-13-19(23)22-20-21-17-6-4-5-7-18(17)25-20/h4-13H,2-3,14H2,1H3,(H,21,22,23)/b13-10+ |
| InChIKey | PNQXHIUEGRHETG-JLHYYAGUSA-N |
| XLogP | 5.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|