C27H26N2O2S — CID 53268809
(E)-N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 53268809) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is (E)-N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53268809 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (E)-N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc2nc(NC(=O)/C=C/c3ccc(OCc4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C27H26N2O2S/c1-27(2,3)21-12-15-23-24(17-21)32-26(28-23)29-25(30)16-11-19-9-13-22(14-10-19)31-18-20-7-5-4-6-8-20/h4-17H,18H2,1-3H3,(H,28,29,30)/b16-11+ |
| InChIKey | AISUOGAWGIHGKH-LFIBNONCSA-N |
| XLogP | 6.82 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|