C20H20N2OS — CID 6139563
(E)-N-(1,3-benzothiazol-2-yl)-3-(4-tert-butylphenyl)prop-2-enamide (PubChem CID 6139563) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(4-tert-butylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-tert-butylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6139563 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(4-tert-butylphenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H20N2OS/c1-20(2,3)15-11-8-14(9-12-15)10-13-18(23)22-19-21-16-6-4-5-7-17(16)24-19/h4-13H,1-3H3,(H,21,22,23)/b13-10+ |
| InChIKey | XKUIFWSETIKOKL-JLHYYAGUSA-N |
| XLogP | 5.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|