C16H13N3OS — CID 115342690
(E)-3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 115342690) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is (E)-3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 115342690 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (E)-3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | Nc1ccc(/C=C/C(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H13N3OS/c17-12-8-5-11(6-9-12)7-10-15(20)19-16-18-13-3-1-2-4-14(13)21-16/h1-10H,17H2,(H,18,19,20)/b10-7+ |
| InChIKey | YXDFAQOFPROPCN-JXMROGBWSA-N |
| XLogP | 3.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|