C17H12ClN3OS2 — CID 1343973
(E)-N-(1,3-benzothiazol-2-ylcarbamothioyl)-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 1343973) has the molecular formula C17H12ClN3OS2 and a molecular weight of 373.89 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-ylcarbamothioyl)-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-ylcarbamothioyl)-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1343973 |
| Molecular Formula | C17H12ClN3OS2 |
| Molecular Weight | 373.89 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-ylcarbamothioyl)-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12ClN3OS2/c18-12-8-5-11(6-9-12)7-10-15(22)20-16(23)21-17-19-13-3-1-2-4-14(13)24-17/h1-10H,(H2,19,20,21,22,23)/b10-7+ |
| InChIKey | WNBUZMVZVZTOFU-JXMROGBWSA-N |
| XLogP | 4.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|