C17H11Cl2N3OS2 — CID 4038292
N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 4038292) has the molecular formula C17H11Cl2N3OS2 and a molecular weight of 408.34 g/mol. Its IUPAC name is N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 4038292 |
| Molecular Formula | C17H11Cl2N3OS2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)NC(=S)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C17H11Cl2N3OS2/c18-11-7-8-12-15(14(11)19)21-17(25-12)22-16(24)20-13(23)9-6-10-4-2-1-3-5-10/h1-9H,(H2,20,21,22,23,24) |
| InChIKey | RBEIXDFOHKHOLE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|