C21H11Cl4N3O2S2 — CID 17316551
(E)-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17316551) has the molecular formula C21H11Cl4N3O2S2 and a molecular weight of 543.28 g/mol. Its IUPAC name is (E)-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17316551 |
| Molecular Formula | C21H11Cl4N3O2S2 |
| Molecular Weight | 543.28 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | (E)-N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C21H11Cl4N3O2S2/c22-10-1-4-12(14(24)9-10)15-6-2-11(30-15)3-8-17(29)26-20(31)28-21-27-19-16(32-21)7-5-13(23)18(19)25/h1-9H,(H2,26,27,28,29,31)/b8-3+ |
| InChIKey | VPKAJYUIWUSNQG-FPYGCLRLSA-N |
| XLogP | 7.70 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.28 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|