C23H15Cl2N3O4S — CID 17113950
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 17113950) has the molecular formula C23H15Cl2N3O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17113950 |
| Molecular Formula | C23H15Cl2N3O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | CN1C(=O)c2ccc(NC(=S)NC(=O)/C=C/c3ccc(-c4ccc(Cl)cc4Cl)o3)cc2C1=O |
| InChI | InChI=1S/C23H15Cl2N3O4S/c1-28-21(30)15-7-3-13(11-17(15)22(28)31)26-23(33)27-20(29)9-5-14-4-8-19(32-14)16-6-2-12(24)10-18(16)25/h2-11H,1H3,(H2,26,27,29,33)/b9-5+ |
| InChIKey | UWHUJEBYHRVWNI-WEVVVXLNSA-N |
| XLogP | 5.01 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|