C26H25Cl2N3O2S — CID 26020572
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 26020572) has the molecular formula C26H25Cl2N3O2S and a molecular weight of 514.48 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 26020572 |
| Molecular Formula | C26H25Cl2N3O2S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | C[C@H]1CCCCN1c1ccc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O2S/c1-17-4-2-3-15-31(17)20-8-6-19(7-9-20)29-26(34)30-25(32)14-11-21-10-13-24(33-21)22-12-5-18(27)16-23(22)28/h5-14,16-17H,2-4,15H2,1H3,(H2,29,30,32,34)/b14-11+/t17-/m0/s1 |
| InChIKey | RXGIQFBNPOUIEP-WKOYGUFESA-N |
| XLogP | 7.16 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|